ChemNet > CAS > 18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene
18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene
상품명칭 |
2-Acetyl-3-methylbenzo[b]thiophene |
영문 이름 |
2-Acetyl-3-methylbenzo[b]thiophene; 2-Acetyl-3-methylthianaphthene; 1-(3-Methylbenzo[b]thiophen-2-yl)ethan-1-one; 1-(3-methyl-1-benzothiophen-6-yl)ethanone; 1-(3-methyl-1-benzothiophen-2-yl)ethanone |
분자식 |
C11H10OS |
분자량 |
190.2615 |
InChI |
InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3 |
cas번호 |
18781-31-2 |
분자 구조 |
|
밀도 |
1.182g/cm3 |
녹는 점 |
79℃ |
비등점 |
319.5°C at 760 mmHg |
굴절 지수 |
1.631 |
인화점 |
147°C |
증기압 |
0.000337mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|